C27H49ClN2O — CID 89337045
(1S,6R)-1-[[(2R)-1-[4-[(4E)-5-chlorohepta-4,6-dien-2-yl]piperidin-1-yl]-3-methylbutan-2-yl]amino]-6-methylnon-8-en-1-ol (PubChem CID 89337045) has the molecular formula C27H49ClN2O and a molecular weight of 453.16 g/mol. Its IUPAC name is (1S,6R)-1-[[(2R)-1-[4-[(4E)-5-chlorohepta-4,6-dien-2-yl]piperidin-1-yl]-3-methylbutan-2-yl]amino]-6-methylnon-8-en-1-ol.
| Compound Name | (1S,6R)-1-[[(2R)-1-[4-[(4E)-5-chlorohepta-4,6-dien-2-yl]piperidin-1-yl]-3-methylbutan-2-yl]amino]-6-methylnon-8-en-1-ol |
|---|---|
| PubChem CID | 89337045 |
| Molecular Formula | C27H49ClN2O |
| Molecular Weight | 453.16 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | (1S,6R)-1-[[(2R)-1-[4-[(4E)-5-chlorohepta-4,6-dien-2-yl]piperidin-1-yl]-3-methylbutan-2-yl]amino]-6-methylnon-8-en-1-ol |
| SMILES | C=CC[C@H](C)CCCC[C@H](O)N[C@@H](CN1CCC(C(C)C/C=C(/Cl)C=C)CC1)C(C)C |
| InChI | InChI=1S/C27H49ClN2O/c1-7-11-22(5)12-9-10-13-27(31)29-26(21(3)4)20-30-18-16-24(17-19-30)23(6)14-15-25(28)8-2/h7-8,15,21-24,26-27,29,31H,1-2,9-14,16-20H2,3-6H3/b25-15+/t22-,23?,26-,27-/m0/s1 |
| InChIKey | CDXGOHWLNQIRMQ-ZCILNOJSSA-N |
| XLogP | 6.74 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.16 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|