C24H30NO4+ — CID 89337316
3-ethyl-5-methoxy-1,3-dimethyl-2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]indol-1-ium (PubChem CID 89337316) has the molecular formula C24H30NO4+ and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-ethyl-5-methoxy-1,3-dimethyl-2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]indol-1-ium.
| Compound Name | 3-ethyl-5-methoxy-1,3-dimethyl-2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]indol-1-ium |
|---|---|
| PubChem CID | 89337316 |
| Molecular Formula | C24H30NO4+ |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 3-ethyl-5-methoxy-1,3-dimethyl-2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]indol-1-ium |
| SMILES | CCC1(C)C(/C=C/c2c(OC)cc(OC)cc2OC)=[N+](C)c2ccc(OC)cc21 |
| InChI | InChI=1S/C24H30NO4/c1-8-24(2)19-13-16(26-4)9-11-20(19)25(3)23(24)12-10-18-21(28-6)14-17(27-5)15-22(18)29-7/h9-15H,8H2,1-7H3/q+1/b12-10+ |
| InChIKey | ZLYWERVUNKKVLZ-ZRDIBKRKSA-N |
| XLogP | 4.83 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|