C26H32N4O3 — CID 89337328
[10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] 3,3-dimethylbutanoate (PubChem CID 89337328) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] 3,3-dimethylbutanoate.
| Compound Name | [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 89337328 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] 3,3-dimethylbutanoate |
| SMILES | CCN(CC)CCNc1ccc2ncn3c4ccc(OC(=O)CC(C)(C)C)cc4c(=O)c1c23 |
| InChI | InChI=1S/C26H32N4O3/c1-6-29(7-2)13-12-27-19-9-10-20-24-23(19)25(32)18-14-17(33-22(31)15-26(3,4)5)8-11-21(18)30(24)16-28-20/h8-11,14,16,27H,6-7,12-13,15H2,1-5H3 |
| InChIKey | IRVRMWISGCVJRH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|