C12H20N2O — CID 89337471
(1E,3E,5Z)-4-(morpholin-4-ylmethyl)hepta-1,3,5-trien-1-amine (PubChem CID 89337471) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (1E,3E,5Z)-4-(morpholin-4-ylmethyl)hepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3E,5Z)-4-(morpholin-4-ylmethyl)hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89337471 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (1E,3E,5Z)-4-(morpholin-4-ylmethyl)hepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C(=C/C=C/N)CN1CCOCC1 |
| InChI | InChI=1S/C12H20N2O/c1-2-4-12(5-3-6-13)11-14-7-9-15-10-8-14/h2-6H,7-11,13H2,1H3/b4-2-,6-3+,12-5+ |
| InChIKey | IOTGPTQOXMLDFN-VMMVVCKDSA-N |
| XLogP | 1.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|