C19H23BO — CID 89337675
(2-ethenyl-4,6-dimethylphenyl)-(2,4,6-trimethylphenyl)borinic acid (PubChem CID 89337675) has the molecular formula C19H23BO and a molecular weight of 278.20 g/mol. Its IUPAC name is (2-ethenyl-4,6-dimethylphenyl)-(2,4,6-trimethylphenyl)borinic acid.
| Compound Name | (2-ethenyl-4,6-dimethylphenyl)-(2,4,6-trimethylphenyl)borinic acid |
|---|---|
| PubChem CID | 89337675 |
| Molecular Formula | C19H23BO |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (2-ethenyl-4,6-dimethylphenyl)-(2,4,6-trimethylphenyl)borinic acid |
| SMILES | C=Cc1cc(C)cc(C)c1B(O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H23BO/c1-7-17-11-13(3)10-16(6)19(17)20(21)18-14(4)8-12(2)9-15(18)5/h7-11,21H,1H2,2-6H3 |
| InChIKey | XPNOEWOQSJARDY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|