C29H36N4O3 — CID 89337793
(10R,15S)-4-ethoxy-13-[3-[ethyl(methyl)amino]propyl]-10-(3-hydroxyphenyl)-15-methyl-12-methylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one (PubChem CID 89337793) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is (10R,15S)-4-ethoxy-13-[3-[ethyl(methyl)amino]propyl]-10-(3-hydroxyphenyl)-15-methyl-12-methylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one.
| Compound Name | (10R,15S)-4-ethoxy-13-[3-[ethyl(methyl)amino]propyl]-10-(3-hydroxyphenyl)-15-methyl-12-methylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
|---|---|
| PubChem CID | 89337793 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (10R,15S)-4-ethoxy-13-[3-[ethyl(methyl)amino]propyl]-10-(3-hydroxyphenyl)-15-methyl-12-methylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
| SMILES | C=C1N(CCCN(C)CC)C(=O)[C@]2(C)Cc3c([nH]c4ccc(OCC)cc34)[C@@H](c3cccc(O)c3)N12 |
| InChI | InChI=1S/C29H36N4O3/c1-6-31(5)14-9-15-32-19(3)33-27(20-10-8-11-21(34)16-20)26-24(18-29(33,4)28(32)35)23-17-22(36-7-2)12-13-25(23)30-26/h8,10-13,16-17,27,30,34H,3,6-7,9,14-15,18H2,1-2,4-5H3/t27-,29+/m1/s1 |
| InChIKey | GCDCDHABGAYTHM-PXJZQJOASA-N |
| XLogP | 4.63 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|