C12H20F2O6S — CID 89338008
1,1-difluoro-2-[[3-(hydroxymethyl)-2,2,3-trimethylcyclopentyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 89338008) has the molecular formula C12H20F2O6S and a molecular weight of 330.35 g/mol. Its IUPAC name is 1,1-difluoro-2-[[3-(hydroxymethyl)-2,2,3-trimethylcyclopentyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[3-(hydroxymethyl)-2,2,3-trimethylcyclopentyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89338008 |
| Molecular Formula | C12H20F2O6S |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1,1-difluoro-2-[[3-(hydroxymethyl)-2,2,3-trimethylcyclopentyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | CC1(CO)CCC(COC(=O)C(F)(F)S(=O)(=O)O)C1(C)C |
| InChI | InChI=1S/C12H20F2O6S/c1-10(2)8(4-5-11(10,3)7-15)6-20-9(16)12(13,14)21(17,18)19/h8,15H,4-7H2,1-3H3,(H,17,18,19) |
| InChIKey | DOMZFHUOPUYNBV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|