About 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine
6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine (PubChem CID 89338096) has the molecular formula C14H14BrClN6O3
and a molecular weight of 429.66 g/mol. Its IUPAC name is 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine |
| PubChem CID | 89338096 |
| Molecular Formula | C14H14BrClN6O3 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine |
| SMILES | COc1nc(Cn2cnc3c(Br)nc(N)nc32)c(Cl)c(OC)c1OC |
| InChI | InChI=1S/C14H14BrClN6O3/c1-23-9-7(16)6(19-13(25-3)10(9)24-2)4-22-5-18-8-11(15)20-14(17)21-12(8)22/h5H,4H2,1-3H3,(H2,17,20,21) |
| InChIKey | SXUPPMJLZPXIDZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine?
The IUPAC name of 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine (CID 89338096) is 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine.
What is the SMILES notation for 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine?
The canonical SMILES for 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine is COc1nc(Cn2cnc3c(Br)nc(N)nc32)c(Cl)c(OC)c1OC.
What is the InChIKey of 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine?
The InChIKey is SXUPPMJLZPXIDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrClN6O3/c1-23-9-7(16)6(19-13(25-3)10(9)24-2)4-22-5-18-8-11(15)20-14(17)21-12(8)22/h5H,4H2,1-3H3,(H2,17,20,21).
What are the key properties of 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine?
6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine has a molecular weight of 429.66 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-9-[(3-chloro-4,5,6-trimethoxy-2-pyridinyl)methyl]purin-2-amine is sourced from PubChem (CID 89338096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).