C18H16O5 — CID 89338123
(12S,16E)-16-ethylidene-13,13-dimethyl-3,11,14-trioxatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),5,8-tetraene-4,15-dione (PubChem CID 89338123) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is (12S,16E)-16-ethylidene-13,13-dimethyl-3,11,14-trioxatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),5,8-tetraene-4,15-dione.
| Compound Name | (12S,16E)-16-ethylidene-13,13-dimethyl-3,11,14-trioxatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),5,8-tetraene-4,15-dione |
|---|---|
| PubChem CID | 89338123 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (12S,16E)-16-ethylidene-13,13-dimethyl-3,11,14-trioxatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),5,8-tetraene-4,15-dione |
| SMILES | C/C=C1/C(=O)OC(C)(C)[C@H]2Oc3ccc4ccc(=O)oc4c3C12 |
| InChI | InChI=1S/C18H16O5/c1-4-10-13-14-11(21-16(13)18(2,3)23-17(10)20)7-5-9-6-8-12(19)22-15(9)14/h4-8,13,16H,1-3H3/b10-4+/t13?,16-/m0/s1 |
| InChIKey | MFDBUYLDXNUOKH-SRJUIAESSA-N |
| XLogP | 2.92 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|