C13H22O5 — CID 89338518
(4S,5R)-4-[(2S,3R)-3-hydroxy-2,3-dimethoxybutan-2-yl]oxy-5-methylcyclohex-2-en-1-one (PubChem CID 89338518) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (4S,5R)-4-[(2S,3R)-3-hydroxy-2,3-dimethoxybutan-2-yl]oxy-5-methylcyclohex-2-en-1-one.
| Compound Name | (4S,5R)-4-[(2S,3R)-3-hydroxy-2,3-dimethoxybutan-2-yl]oxy-5-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 89338518 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (4S,5R)-4-[(2S,3R)-3-hydroxy-2,3-dimethoxybutan-2-yl]oxy-5-methylcyclohex-2-en-1-one |
| SMILES | CO[C@@](C)(O[C@@H]1C=CC(=O)C[C@H]1C)[C@](C)(O)OC |
| InChI | InChI=1S/C13H22O5/c1-9-8-10(14)6-7-11(9)18-13(3,17-5)12(2,15)16-4/h6-7,9,11,15H,8H2,1-5H3/t9-,11-,12-,13+/m1/s1 |
| InChIKey | KRJFLARKCAUIMQ-JHEVNIALSA-N |
| XLogP | 1.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|