C19H36O6Si — CID 89338520
2-[(5R)-5-[(4S)-2,2-dimethyl-5-triethylsilyloxy-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 89338520) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is 2-[(5R)-5-[(4S)-2,2-dimethyl-5-triethylsilyloxy-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | 2-[(5R)-5-[(4S)-2,2-dimethyl-5-triethylsilyloxy-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 89338520 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2-[(5R)-5-[(4S)-2,2-dimethyl-5-triethylsilyloxy-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)OC1COC(C)(C)O[C@H]1[C@@H]1OC(C)(C)OC1CC=O |
| InChI | InChI=1S/C19H36O6Si/c1-8-26(9-2,10-3)25-15-13-21-18(4,5)23-17(15)16-14(11-12-20)22-19(6,7)24-16/h12,14-17H,8-11,13H2,1-7H3/t14?,15?,16-,17-/m1/s1 |
| InChIKey | NVFZABNNOVSUHP-BHUNQDJPSA-N |
| XLogP | 3.64 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|