C20H13F3IN5 — CID 89338710
N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine (PubChem CID 89338710) has the molecular formula C20H13F3IN5 and a molecular weight of 507.26 g/mol. Its IUPAC name is N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine.
| Compound Name | N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine |
|---|---|
| PubChem CID | 89338710 |
| Molecular Formula | C20H13F3IN5 |
| Molecular Weight | 507.26 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine |
| SMILES | FC(F)(F)c1cccnc1-c1ccc2c(Nc3ccc(CI)cc3)cnnc2n1 |
| InChI | InChI=1S/C20H13F3IN5/c21-20(22,23)15-2-1-9-25-18(15)16-8-7-14-17(11-26-29-19(14)28-16)27-13-5-3-12(10-24)4-6-13/h1-9,11H,10H2,(H,27,28,29) |
| InChIKey | SMNCRJKSRZOICH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.26 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|