About N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine
N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine (PubChem CID 89338710) has the molecular formula C20H13F3IN5
and a molecular weight of 507.26 g/mol. Its IUPAC name is N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine.
Molecular Properties
| Compound Name | N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine |
| PubChem CID | 89338710 |
| Molecular Formula | C20H13F3IN5 |
| Molecular Weight | 507.26 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine |
| SMILES | FC(F)(F)c1cccnc1-c1ccc2c(Nc3ccc(CI)cc3)cnnc2n1 |
| InChI | InChI=1S/C20H13F3IN5/c21-20(22,23)15-2-1-9-25-18(15)16-8-7-14-17(11-26-29-19(14)28-16)27-13-5-3-12(10-24)4-6-13/h1-9,11H,10H2,(H,27,28,29) |
| InChIKey | SMNCRJKSRZOICH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.26 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine?
The IUPAC name of N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine (CID 89338710) is N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine.
What is the SMILES notation for N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine?
The canonical SMILES for N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine is FC(F)(F)c1cccnc1-c1ccc2c(Nc3ccc(CI)cc3)cnnc2n1.
What is the InChIKey of N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine?
The InChIKey is SMNCRJKSRZOICH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3IN5/c21-20(22,23)15-2-1-9-25-18(15)16-8-7-14-17(11-26-29-19(14)28-16)27-13-5-3-12(10-24)4-6-13/h1-9,11H,10H2,(H,27,28,29).
What are the key properties of N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine?
N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine has a molecular weight of 507.26 g/mol, XLogP of 5.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(iodomethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[2,3-c]pyridazin-4-amine is sourced from PubChem (CID 89338710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).