About (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol
(2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol (PubChem CID 89339374) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol.
Molecular Properties
| Compound Name | (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol |
| PubChem CID | 89339374 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol |
| SMILES | C=C(C)NC(=C/CC)/C(O)=C\C |
| InChI | InChI=1S/C10H17NO/c1-5-7-9(10(12)6-2)11-8(3)4/h6-7,11-12H,3,5H2,1-2,4H3/b9-7+,10-6+ |
| InChIKey | PBVMJARCULQOFT-IDXDHNASSA-N |
| XLogP | 2.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol?
The IUPAC name of (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol (CID 89339374) is (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol.
What is the SMILES notation for (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol?
The canonical SMILES for (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol is C=C(C)NC(=C/CC)/C(O)=C\C.
What is the InChIKey of (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol?
The InChIKey is PBVMJARCULQOFT-IDXDHNASSA-N. The full InChI is InChI=1S/C10H17NO/c1-5-7-9(10(12)6-2)11-8(3)4/h6-7,11-12H,3,5H2,1-2,4H3/b9-7+,10-6+.
What are the key properties of (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol?
(2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol has a molecular weight of 167.25 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-4-(prop-1-en-2-ylamino)hepta-2,4-dien-3-ol is sourced from PubChem (CID 89339374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).