C16H23NO — CID 89339538
(1Z,3Z)-1-[(3R)-3,6-dimethylcyclohexa-1,5-dien-1-yl]-2-(methyliminomethyl)hexa-1,3-dien-3-ol (PubChem CID 89339538) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (1Z,3Z)-1-[(3R)-3,6-dimethylcyclohexa-1,5-dien-1-yl]-2-(methyliminomethyl)hexa-1,3-dien-3-ol.
| Compound Name | (1Z,3Z)-1-[(3R)-3,6-dimethylcyclohexa-1,5-dien-1-yl]-2-(methyliminomethyl)hexa-1,3-dien-3-ol |
|---|---|
| PubChem CID | 89339538 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (1Z,3Z)-1-[(3R)-3,6-dimethylcyclohexa-1,5-dien-1-yl]-2-(methyliminomethyl)hexa-1,3-dien-3-ol |
| SMILES | CC/C=C(O)/C(=C\C1=C[C@H](C)CC=C1C)/C=N/C |
| InChI | InChI=1S/C16H23NO/c1-5-6-16(18)15(11-17-4)10-14-9-12(2)7-8-13(14)3/h6,8-12,18H,5,7H2,1-4H3/b15-10-,16-6-,17-11+/t12-/m1/s1 |
| InChIKey | ZWMYKSUKDRBQBL-UVARPENISA-N |
| XLogP | 4.38 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|