About 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene
3-fluoro-2,4-dimethyl-2,3-dihydrothiophene (PubChem CID 89339542) has the molecular formula C6H9FS
and a molecular weight of 132.20 g/mol. Its IUPAC name is 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene |
| PubChem CID | 89339542 |
| Molecular Formula | C6H9FS |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene |
| SMILES | CC1=CSC(C)C1F |
| InChI | InChI=1S/C6H9FS/c1-4-3-8-5(2)6(4)7/h3,5-6H,1-2H3 |
| InChIKey | IKJZECLNALUPQW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene?
The IUPAC name of 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene (CID 89339542) is 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene.
What is the SMILES notation for 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene?
The canonical SMILES for 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene is CC1=CSC(C)C1F.
What is the InChIKey of 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene?
The InChIKey is IKJZECLNALUPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FS/c1-4-3-8-5(2)6(4)7/h3,5-6H,1-2H3.
What are the key properties of 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene?
3-fluoro-2,4-dimethyl-2,3-dihydrothiophene has a molecular weight of 132.20 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,4-dimethyl-2,3-dihydrothiophene is sourced from PubChem (CID 89339542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).