C32H42N2O3 — CID 89339644
6-[(2E)-2-[(2E,4Z)-4-(4-amino-2-hydroxyphenyl)-7,7-dimethylocta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoic acid (PubChem CID 89339644) has the molecular formula C32H42N2O3 and a molecular weight of 502.70 g/mol. Its IUPAC name is 6-[(2E)-2-[(2E,4Z)-4-(4-amino-2-hydroxyphenyl)-7,7-dimethylocta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(2E,4Z)-4-(4-amino-2-hydroxyphenyl)-7,7-dimethylocta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 89339644 |
| Molecular Formula | C32H42N2O3 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | 6-[(2E)-2-[(2E,4Z)-4-(4-amino-2-hydroxyphenyl)-7,7-dimethylocta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoic acid |
| SMILES | CC(C)(C)C/C=C(/C=C/C=C1/N(CCCCCC(=O)O)c2ccccc2C1(C)C)c1ccc(N)cc1O |
| InChI | InChI=1S/C32H42N2O3/c1-31(2,3)20-19-23(25-18-17-24(33)22-28(25)35)12-11-15-29-32(4,5)26-13-8-9-14-27(26)34(29)21-10-6-7-16-30(36)37/h8-9,11-15,17-19,22,35H,6-7,10,16,20-21,33H2,1-5H3,(H,36,37)/b12-11+,23-19-,29-15+ |
| InChIKey | MZJZGFKBGFSKNQ-AQKXCBNOSA-N |
| XLogP | 7.68 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|