About N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide
N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide (PubChem CID 89339684) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide.
Molecular Properties
| Compound Name | N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide |
| PubChem CID | 89339684 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide |
| SMILES | [H]/N=C(/C1C=CN=CC1)N(C)C |
| InChI | InChI=1S/C8H13N3/c1-11(2)8(9)7-3-5-10-6-4-7/h3,5-7,9H,4H2,1-2H3/b9-8- |
| InChIKey | MBGXKRVFYIZYPZ-HJWRWDBZSA-N |
| XLogP | 1.13 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide?
The IUPAC name of N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide (CID 89339684) is N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide.
What is the SMILES notation for N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide?
The canonical SMILES for N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide is [H]/N=C(/C1C=CN=CC1)N(C)C.
What is the InChIKey of N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide?
The InChIKey is MBGXKRVFYIZYPZ-HJWRWDBZSA-N. The full InChI is InChI=1S/C8H13N3/c1-11(2)8(9)7-3-5-10-6-4-7/h3,5-7,9H,4H2,1-2H3/b9-8-.
What are the key properties of N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide?
N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide has a molecular weight of 151.21 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3,4-dihydropyridine-4-carboximidamide is sourced from PubChem (CID 89339684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).