C22H24BN5O2 — CID 89339716
CID 89339716 (PubChem CID 89339716) has the molecular formula C22H24BN5O2 and a molecular weight of 401.28 g/mol.
| Compound Name | CID 89339716 |
|---|---|
| PubChem CID | 89339716 |
| Molecular Formula | C22H24BN5O2 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2c(c1)/C(=C/c1[nH]c3c(c1C)C(=O)N(CCN1CCCC1)CC3)C(=O)N2 |
| InChI | InChI=1S/C22H24BN5O2/c1-13-18(11-16-15-10-14(23)12-24-20(15)26-21(16)29)25-17-4-7-28(22(30)19(13)17)9-8-27-5-2-3-6-27/h10-12,25H,2-9H2,1H3,(H,24,26,29)/b16-11- |
| InChIKey | DLRIXYVDOODKHK-WJDWOHSUSA-N |
| XLogP | 1.10 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|