C23H25ClFN9OS — CID 89339724
N'-amino-2-[[4-(3-chloro-2-fluorobenzoyl)piperazin-1-yl]methyl]-N-methyl-N-(methylideneamino)-6-(1,3-thiazol-2-ylamino)pyridine-4-carboximidamide (PubChem CID 89339724) has the molecular formula C23H25ClFN9OS and a molecular weight of 530.03 g/mol. Its IUPAC name is N'-amino-2-[[4-(3-chloro-2-fluorobenzoyl)piperazin-1-yl]methyl]-N-methyl-N-(methylideneamino)-6-(1,3-thiazol-2-ylamino)pyridine-4-carboximidamide.
| Compound Name | N'-amino-2-[[4-(3-chloro-2-fluorobenzoyl)piperazin-1-yl]methyl]-N-methyl-N-(methylideneamino)-6-(1,3-thiazol-2-ylamino)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 89339724 |
| Molecular Formula | C23H25ClFN9OS |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | N'-amino-2-[[4-(3-chloro-2-fluorobenzoyl)piperazin-1-yl]methyl]-N-methyl-N-(methylideneamino)-6-(1,3-thiazol-2-ylamino)pyridine-4-carboximidamide |
| SMILES | C=NN(C)/C(=N\N)c1cc(CN2CCN(C(=O)c3cccc(Cl)c3F)CC2)nc(Nc2nccs2)c1 |
| InChI | InChI=1S/C23H25ClFN9OS/c1-27-32(2)21(31-26)15-12-16(29-19(13-15)30-23-28-6-11-36-23)14-33-7-9-34(10-8-33)22(35)17-4-3-5-18(24)20(17)25/h3-6,11-13H,1,7-10,14,26H2,2H3,(H,28,29,30)/b31-21- |
| InChIKey | FYEGPNPSFYIEMK-YQYKVWLJSA-N |
| XLogP | 3.20 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|