C8H17NO2 — CID 89339806
(3S,6S)-4-amino-2,4,6-trimethyloxan-3-ol (PubChem CID 89339806) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (3S,6S)-4-amino-2,4,6-trimethyloxan-3-ol.
| Compound Name | (3S,6S)-4-amino-2,4,6-trimethyloxan-3-ol |
|---|---|
| PubChem CID | 89339806 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (3S,6S)-4-amino-2,4,6-trimethyloxan-3-ol |
| SMILES | CC1O[C@@H](C)CC(C)(N)[C@@H]1O |
| InChI | InChI=1S/C8H17NO2/c1-5-4-8(3,9)7(10)6(2)11-5/h5-7,10H,4,9H2,1-3H3/t5-,6?,7+,8?/m0/s1 |
| InChIKey | NSGNYLSWJZTBIN-AEMDVCDZSA-N |
| XLogP | 0.26 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |