About (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine
(R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine (PubChem CID 89339828) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine |
| PubChem CID | 89339828 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine |
| SMILES | CO[C@@H](N)c1cc(C)no1 |
| InChI | InChI=1S/C6H10N2O2/c1-4-3-5(10-8-4)6(7)9-2/h3,6H,7H2,1-2H3/t6-/m1/s1 |
| InChIKey | HLXRYENRPSLLTP-ZCFIWIBFSA-N |
| XLogP | 0.59 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine?
The IUPAC name of (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine (CID 89339828) is (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine.
What is the SMILES notation for (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine?
The canonical SMILES for (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine is CO[C@@H](N)c1cc(C)no1.
What is the InChIKey of (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine?
The InChIKey is HLXRYENRPSLLTP-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-4-3-5(10-8-4)6(7)9-2/h3,6H,7H2,1-2H3/t6-/m1/s1.
What are the key properties of (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine?
(R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine has a molecular weight of 142.16 g/mol, XLogP of 0.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-methoxy-(3-methyl-1,2-oxazol-5-yl)methanamine is sourced from PubChem (CID 89339828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).