About 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid
5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid (PubChem CID 89339850) has the molecular formula C9H8FNO4
and a molecular weight of 213.16 g/mol. Its IUPAC name is 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid.
Molecular Properties
| Compound Name | 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid |
| PubChem CID | 89339850 |
| Molecular Formula | C9H8FNO4 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid |
| SMILES | CC1(F)C=CC=C(C(=O)O)C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C9H8FNO4/c1-9(10)4-2-3-6(8(12)13)7(5-9)11(14)15/h2-5H,1H3,(H,12,13) |
| InChIKey | ZVJIJNLQLAUHBG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid?
The IUPAC name of 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid (CID 89339850) is 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid.
What is the SMILES notation for 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid?
The canonical SMILES for 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid is CC1(F)C=CC=C(C(=O)O)C([N+](=O)[O-])=C1.
What is the InChIKey of 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid?
The InChIKey is ZVJIJNLQLAUHBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO4/c1-9(10)4-2-3-6(8(12)13)7(5-9)11(14)15/h2-5H,1H3,(H,12,13).
What are the key properties of 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid?
5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid has a molecular weight of 213.16 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-5-methyl-7-nitrocyclohepta-1,3,6-triene-1-carboxylic acid is sourced from PubChem (CID 89339850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).