About [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol
[(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol (PubChem CID 89339936) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol |
| PubChem CID | 89339936 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol |
| SMILES | [H]/N=C/[C@H]1C=CC(CO)=C[C@H]1OC |
| InChI | InChI=1S/C9H13NO2/c1-12-9-4-7(6-11)2-3-8(9)5-10/h2-5,8-11H,6H2,1H3/b10-5+/t8-,9-/m1/s1 |
| InChIKey | RDEBXAVNJWQRCQ-SDEVKPEUSA-N |
| XLogP | 0.76 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol?
The IUPAC name of [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol (CID 89339936) is [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol.
What is the SMILES notation for [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol?
The canonical SMILES for [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol is [H]/N=C/[C@H]1C=CC(CO)=C[C@H]1OC.
What is the InChIKey of [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol?
The InChIKey is RDEBXAVNJWQRCQ-SDEVKPEUSA-N. The full InChI is InChI=1S/C9H13NO2/c1-12-9-4-7(6-11)2-3-8(9)5-10/h2-5,8-11H,6H2,1H3/b10-5+/t8-,9-/m1/s1.
What are the key properties of [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol?
[(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol has a molecular weight of 167.21 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-methanimidoyl-3-methoxycyclohexa-1,5-dien-1-yl]methanol is sourced from PubChem (CID 89339936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).