About (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene
(6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene (PubChem CID 89339975) has the molecular formula C8H10F2O
and a molecular weight of 160.16 g/mol. Its IUPAC name is (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene.
Analyze (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene?
The IUPAC name of (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene (CID 89339975) is (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene.
What is the SMILES notation for (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene?
The canonical SMILES for (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene is C[C@@H]1CC=CC=C1OC(F)F.
What is the InChIKey of (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene?
The InChIKey is YBNMPJDBIQFYPP-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H10F2O/c1-6-4-2-3-5-7(6)11-8(9)10/h2-3,5-6,8H,4H2,1H3/t6-/m1/s1.
What are the key properties of (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene?
(6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene has a molecular weight of 160.16 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-1-(difluoromethoxy)-6-methylcyclohexa-1,3-diene is sourced from PubChem (CID 89339975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).