About 2-(fluoromethoxy)-1,3,4-trimethylbenzene
2-(fluoromethoxy)-1,3,4-trimethylbenzene (PubChem CID 89340105) has the molecular formula C10H13FO
and a molecular weight of 168.21 g/mol. Its IUPAC name is 2-(fluoromethoxy)-1,3,4-trimethylbenzene.
Molecular Properties
| Compound Name | 2-(fluoromethoxy)-1,3,4-trimethylbenzene |
| PubChem CID | 89340105 |
| Molecular Formula | C10H13FO |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-(fluoromethoxy)-1,3,4-trimethylbenzene |
| SMILES | Cc1ccc(C)c(OCF)c1C |
| InChI | InChI=1S/C10H13FO/c1-7-4-5-8(2)10(9(7)3)12-6-11/h4-5H,6H2,1-3H3 |
| InChIKey | WHKOYBNJSHHUIM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(fluoromethoxy)-1,3,4-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethoxy)-1,3,4-trimethylbenzene?
The IUPAC name of 2-(fluoromethoxy)-1,3,4-trimethylbenzene (CID 89340105) is 2-(fluoromethoxy)-1,3,4-trimethylbenzene.
What is the SMILES notation for 2-(fluoromethoxy)-1,3,4-trimethylbenzene?
The canonical SMILES for 2-(fluoromethoxy)-1,3,4-trimethylbenzene is Cc1ccc(C)c(OCF)c1C.
What is the InChIKey of 2-(fluoromethoxy)-1,3,4-trimethylbenzene?
The InChIKey is WHKOYBNJSHHUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO/c1-7-4-5-8(2)10(9(7)3)12-6-11/h4-5H,6H2,1-3H3.
What are the key properties of 2-(fluoromethoxy)-1,3,4-trimethylbenzene?
2-(fluoromethoxy)-1,3,4-trimethylbenzene has a molecular weight of 168.21 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethoxy)-1,3,4-trimethylbenzene is sourced from PubChem (CID 89340105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).