C20H20ClIN2O2 — CID 89340135
N-[2-[2-[3-chloro-2-(iodomethyl)phenyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide (PubChem CID 89340135) has the molecular formula C20H20ClIN2O2 and a molecular weight of 482.75 g/mol. Its IUPAC name is N-[2-[2-[3-chloro-2-(iodomethyl)phenyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[2-[3-chloro-2-(iodomethyl)phenyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 89340135 |
| Molecular Formula | C20H20ClIN2O2 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | N-[2-[2-[3-chloro-2-(iodomethyl)phenyl]-5-methoxy-1H-indol-3-yl]ethyl]acetamide |
| SMILES | COc1ccc2[nH]c(-c3cccc(Cl)c3CI)c(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C20H20ClIN2O2/c1-12(25)23-9-8-15-16-10-13(26-2)6-7-19(16)24-20(15)14-4-3-5-18(21)17(14)11-22/h3-7,10,24H,8-9,11H2,1-2H3,(H,23,25) |
| InChIKey | JTEROYAYRNGGTG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|