C9H17NS — CID 89340268
(6Z,9R)-2,9-dimethyl-2,3,4,5,8,9-hexahydro-1,3-thiazonine (PubChem CID 89340268) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is (6Z,9R)-2,9-dimethyl-2,3,4,5,8,9-hexahydro-1,3-thiazonine.
| Compound Name | (6Z,9R)-2,9-dimethyl-2,3,4,5,8,9-hexahydro-1,3-thiazonine |
|---|---|
| PubChem CID | 89340268 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (6Z,9R)-2,9-dimethyl-2,3,4,5,8,9-hexahydro-1,3-thiazonine |
| SMILES | CC1NCC/C=C\C[C@@H](C)S1 |
| InChI | InChI=1S/C9H17NS/c1-8-6-4-3-5-7-10-9(2)11-8/h3-4,8-10H,5-7H2,1-2H3/b4-3-/t8-,9?/m1/s1 |
| InChIKey | TXCGMOXWABVVEO-UXBGSERHSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|