About (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine
(E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine (PubChem CID 89340277) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine.
Molecular Properties
| Compound Name | (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine |
| PubChem CID | 89340277 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine |
| SMILES | Cc1nncn1/C=C/N |
| InChI | InChI=1S/C5H8N4/c1-5-8-7-4-9(5)3-2-6/h2-4H,6H2,1H3/b3-2+ |
| InChIKey | CPSFAXIKLGLXDH-NSCUHMNNSA-N |
| XLogP | -0.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine?
The IUPAC name of (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine (CID 89340277) is (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine.
What is the SMILES notation for (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine?
The canonical SMILES for (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine is Cc1nncn1/C=C/N.
What is the InChIKey of (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine?
The InChIKey is CPSFAXIKLGLXDH-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H8N4/c1-5-8-7-4-9(5)3-2-6/h2-4H,6H2,1H3/b3-2+.
What are the key properties of (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine?
(E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine has a molecular weight of 124.15 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(3-methyl-1,2,4-triazol-4-yl)ethenamine is sourced from PubChem (CID 89340277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).