C8H13NS — CID 89340289
(3aR,7aS)-2-methyl-2,3,3a,4,7,7a-hexahydro-1,3-benzothiazole (PubChem CID 89340289) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is (3aR,7aS)-2-methyl-2,3,3a,4,7,7a-hexahydro-1,3-benzothiazole.
| Compound Name | (3aR,7aS)-2-methyl-2,3,3a,4,7,7a-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 89340289 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (3aR,7aS)-2-methyl-2,3,3a,4,7,7a-hexahydro-1,3-benzothiazole |
| SMILES | CC1N[C@@H]2CC=CC[C@@H]2S1 |
| InChI | InChI=1S/C8H13NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2-3,6-9H,4-5H2,1H3/t6?,7-,8+/m1/s1 |
| InChIKey | SGJYUVBJFIFKBT-VVXQKDJTSA-N |
| XLogP | 1.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|