C32H35F3N8O3 — CID 89340293
tert-butyl N-[1-[6-[(3-amino-4-methanimidoylphenyl)carbamoyl]-2-[2-(trifluoromethyl)anilino]-1H-benzimidazol-5-yl]piperidin-4-yl]carbamate (PubChem CID 89340293) has the molecular formula C32H35F3N8O3 and a molecular weight of 636.68 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[(3-amino-4-methanimidoylphenyl)carbamoyl]-2-[2-(trifluoromethyl)anilino]-1H-benzimidazol-5-yl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[(3-amino-4-methanimidoylphenyl)carbamoyl]-2-[2-(trifluoromethyl)anilino]-1H-benzimidazol-5-yl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 89340293 |
| Molecular Formula | C32H35F3N8O3 |
| Molecular Weight | 636.68 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | tert-butyl N-[1-[6-[(3-amino-4-methanimidoylphenyl)carbamoyl]-2-[2-(trifluoromethyl)anilino]-1H-benzimidazol-5-yl]piperidin-4-yl]carbamate |
| SMILES | [H]/N=C/c1ccc(NC(=O)c2cc3[nH]c(Nc4ccccc4C(F)(F)F)nc3cc2N2CCC(NC(=O)OC(C)(C)C)CC2)cc1N |
| InChI | InChI=1S/C32H35F3N8O3/c1-31(2,3)46-30(45)39-19-10-12-43(13-11-19)27-16-26-25(15-21(27)28(44)38-20-9-8-18(17-36)23(37)14-20)41-29(42-26)40-24-7-5-4-6-22(24)32(33,34)35/h4-9,14-17,19,36H,10-13,37H2,1-3H3,(H,38,44)(H,39,45)(H2,40,41,42)/b36-17+ |
| InChIKey | VXAIJFMCWLXNEB-KULFSUQXSA-N |
| XLogP | 6.65 |
| TPSA | 161.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|