About 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine
1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine (PubChem CID 89340458) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine |
| PubChem CID | 89340458 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine |
| SMILES | C=CC1=CC(N2CCNCC2)=CCC1 |
| InChI | InChI=1S/C12H18N2/c1-2-11-4-3-5-12(10-11)14-8-6-13-7-9-14/h2,5,10,13H,1,3-4,6-9H2 |
| InChIKey | YRSRGOKDXLEURS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine?
The IUPAC name of 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine (CID 89340458) is 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine.
What is the SMILES notation for 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine?
The canonical SMILES for 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine is C=CC1=CC(N2CCNCC2)=CCC1.
What is the InChIKey of 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine?
The InChIKey is YRSRGOKDXLEURS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-2-11-4-3-5-12(10-11)14-8-6-13-7-9-14/h2,5,10,13H,1,3-4,6-9H2.
What are the key properties of 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine?
1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine has a molecular weight of 190.29 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethenylcyclohexa-1,5-dien-1-yl)piperazine is sourced from PubChem (CID 89340458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).