About (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one
(3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one (PubChem CID 89340690) has the molecular formula C15H18NO+
and a molecular weight of 228.31 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one.
Molecular Properties
| Compound Name | (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one |
| PubChem CID | 89340690 |
| Molecular Formula | C15H18NO+ |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one |
| SMILES | C=C(C)/C=C\C(=C/C)C(=O)C[n+]1ccccc1 |
| InChI | InChI=1S/C15H18NO/c1-4-14(9-8-13(2)3)15(17)12-16-10-6-5-7-11-16/h4-11H,2,12H2,1,3H3/q+1/b9-8-,14-4+ |
| InChIKey | XOVJEXBBFFYVEF-HCILYLEDSA-N |
| XLogP | 2.62 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one?
The IUPAC name of (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one (CID 89340690) is (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one.
What is the SMILES notation for (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one?
The canonical SMILES for (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one is C=C(C)/C=C\C(=C/C)C(=O)C[n+]1ccccc1.
What is the InChIKey of (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one?
The InChIKey is XOVJEXBBFFYVEF-HCILYLEDSA-N. The full InChI is InChI=1S/C15H18NO/c1-4-14(9-8-13(2)3)15(17)12-16-10-6-5-7-11-16/h4-11H,2,12H2,1,3H3/q+1/b9-8-,14-4+.
What are the key properties of (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one?
(3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one has a molecular weight of 228.31 g/mol, XLogP of 2.62, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4Z)-3-ethylidene-6-methyl-1-pyridin-1-ium-1-ylhepta-4,6-dien-2-one is sourced from PubChem (CID 89340690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).