C25H37ClN4O — CID 89340811
1-[4-[1-[N-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propyl]-3-chloro-4-methylanilino]ethenyl]piperidin-1-yl]ethanone (PubChem CID 89340811) has the molecular formula C25H37ClN4O and a molecular weight of 445.05 g/mol. Its IUPAC name is 1-[4-[1-[N-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propyl]-3-chloro-4-methylanilino]ethenyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[1-[N-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propyl]-3-chloro-4-methylanilino]ethenyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 89340811 |
| Molecular Formula | C25H37ClN4O |
| Molecular Weight | 445.05 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 1-[4-[1-[N-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propyl]-3-chloro-4-methylanilino]ethenyl]piperidin-1-yl]ethanone |
| SMILES | C=C(C1CCN(C(C)=O)CC1)N(CCCN1CC2CNCC2C1)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C25H37ClN4O/c1-18-5-6-24(13-25(18)26)30(19(2)21-7-11-29(12-8-21)20(3)31)10-4-9-28-16-22-14-27-15-23(22)17-28/h5-6,13,21-23,27H,2,4,7-12,14-17H2,1,3H3 |
| InChIKey | MZSVAOJYGAGRGM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.05 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |