C19H19F6NO4 — CID 89340870
methyl (6R,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate (PubChem CID 89340870) has the molecular formula C19H19F6NO4 and a molecular weight of 439.35 g/mol. Its IUPAC name is methyl (6R,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate.
| Compound Name | methyl (6R,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 89340870 |
| Molecular Formula | C19H19F6NO4 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | methyl (6R,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate |
| SMILES | COC(=O)C1C[C@H]2C[C@@H](O[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CN2C1=O |
| InChI | InChI=1S/C19H19F6NO4/c1-9(10-3-11(18(20,21)22)5-12(4-10)19(23,24)25)30-14-6-13-7-15(17(28)29-2)16(27)26(13)8-14/h3-5,9,13-15H,6-8H2,1-2H3/t9-,13-,14-,15?/m1/s1 |
| InChIKey | FLSMCZWCUJRREZ-RMWGGLLESA-N |
| XLogP | 3.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|