C11H15NS — CID 89341111
5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-methyl-4H-1,4-thiazine (PubChem CID 89341111) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-methyl-4H-1,4-thiazine.
| Compound Name | 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-methyl-4H-1,4-thiazine |
|---|---|
| PubChem CID | 89341111 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-methyl-4H-1,4-thiazine |
| SMILES | C/C=C\C=C(/C)C1=CSC(C)=CN1 |
| InChI | InChI=1S/C11H15NS/c1-4-5-6-9(2)11-8-13-10(3)7-12-11/h4-8,12H,1-3H3/b5-4-,9-6+ |
| InChIKey | PKTKUCWZSONXJH-KMOPYBJPSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|