C17H26N6O4 — CID 8934160
(1-butyltetrazol-5-yl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 8934160) has the molecular formula C17H26N6O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 8934160 |
| Molecular Formula | C17H26N6O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | CCCCn1nnnc1COC(=O)CN1C(=O)N[C@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C17H26N6O4/c1-3-4-9-23-13(19-20-21-23)11-27-14(24)10-22-15(25)17(18-16(22)26)8-6-5-7-12(17)2/h12H,3-11H2,1-2H3,(H,18,26)/t12-,17-/m0/s1 |
| InChIKey | HXRLJEBAZJDQNJ-SJCJKPOMSA-N |
| XLogP | 1.02 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|