C47H54BN4O10 — CID 89341733
CID 89341733 (PubChem CID 89341733) has the molecular formula C47H54BN4O10 and a molecular weight of 845.78 g/mol.
| Compound Name | CID 89341733 |
|---|---|
| PubChem CID | 89341733 |
| Molecular Formula | C47H54BN4O10 |
| Molecular Weight | 845.78 g/mol |
| Exact Mass | 845.39 |
| IUPAC Name | — |
| SMILES | CC[C@]1(O)C[C@H]2CN(CCC3=C([B]c4ccc(C#N)cc43)[C@@](C(=O)OC)(C3C=C4C(=CC3OC)N(C=O)[C@@]35O[C@]3(C(=O)OC)[C@H](OC(C)=O)[C@]3(CC)C=CCN6CC[C@]45[C@@H]63)C2)C1 |
| InChI | InChI=1S/C47H54BN4O10/c1-7-42(57)21-29-22-44(40(55)59-5,37-30(12-16-50(24-29)25-42)31-18-28(23-49)10-11-34(31)48-37)33-19-32-35(20-36(33)58-4)52(26-53)47-45(32)14-17-51-15-9-13-43(8-2,38(45)51)39(61-27(3)54)46(47,62-47)41(56)60-6/h9-11,13,18-20,26,29,33,36,38-39,57H,7-8,12,14-17,21-22,24-25H2,1-6H3/t29-,33?,36?,38+,39-,42+,43-,44+,45-,46+,47+/m1/s1 |
| InChIKey | ICSXCJUQXIPMOJ-GMMUBUDXSA-N |
| XLogP | 2.57 |
| TPSA | 171.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.78 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|