About 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile
2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile (PubChem CID 89341929) has the molecular formula C48H30N4O2
and a molecular weight of 694.79 g/mol. Its IUPAC name is 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile |
| PubChem CID | 89341929 |
| Molecular Formula | C48H30N4O2 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.24 |
| IUPAC Name | 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(/C=C/c2ccc3c(c2)Oc2ccccc2N3c2ccccc2)c(C#N)cc1/C=C/c1ccc2c(c1)Oc1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C48H30N4O2/c49-31-37-30-36(24-20-34-22-26-44-48(28-34)54-46-18-10-8-16-42(46)52(44)40-13-5-2-6-14-40)38(32-50)29-35(37)23-19-33-21-25-43-47(27-33)53-45-17-9-7-15-41(45)51(43)39-11-3-1-4-12-39/h1-30H/b23-19+,24-20+ |
| InChIKey | BNFUWLNMCZYVEG-BLVCXSLXSA-N |
| XLogP | 12.92 |
| TPSA | 72.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile?
The IUPAC name of 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile (CID 89341929) is 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile.
What is the SMILES notation for 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile?
The canonical SMILES for 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile is N#Cc1cc(/C=C/c2ccc3c(c2)Oc2ccccc2N3c2ccccc2)c(C#N)cc1/C=C/c1ccc2c(c1)Oc1ccccc1N2c1ccccc1.
What is the InChIKey of 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile?
The InChIKey is BNFUWLNMCZYVEG-BLVCXSLXSA-N. The full InChI is InChI=1S/C48H30N4O2/c49-31-37-30-36(24-20-34-22-26-44-48(28-34)54-46-18-10-8-16-42(46)52(44)40-13-5-2-6-14-40)38(32-50)29-35(37)23-19-33-21-25-43-47(27-33)53-45-17-9-7-15-41(45)51(43)39-11-3-1-4-12-39/h1-30H/b23-19+,24-20+.
What are the key properties of 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile?
2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile has a molecular weight of 694.79 g/mol, XLogP of 12.92, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[(E)-2-(10-phenylphenoxazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile is sourced from PubChem (CID 89341929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).