C9H5F14NO3 — CID 89342504
2-[difluoro-[1,1,2,2-tetrafluoroethyl-(1,1,2,2-tetrafluoro-2-methoxyethyl)amino]methyl]-2,3,3,3-tetrafluoropropanoic acid (PubChem CID 89342504) has the molecular formula C9H5F14NO3 and a molecular weight of 441.12 g/mol. Its IUPAC name is 2-[difluoro-[1,1,2,2-tetrafluoroethyl-(1,1,2,2-tetrafluoro-2-methoxyethyl)amino]methyl]-2,3,3,3-tetrafluoropropanoic acid.
| Compound Name | 2-[difluoro-[1,1,2,2-tetrafluoroethyl-(1,1,2,2-tetrafluoro-2-methoxyethyl)amino]methyl]-2,3,3,3-tetrafluoropropanoic acid |
|---|---|
| PubChem CID | 89342504 |
| Molecular Formula | C9H5F14NO3 |
| Molecular Weight | 441.12 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | 2-[difluoro-[1,1,2,2-tetrafluoroethyl-(1,1,2,2-tetrafluoro-2-methoxyethyl)amino]methyl]-2,3,3,3-tetrafluoropropanoic acid |
| SMILES | COC(F)(F)C(F)(F)N(C(F)(F)C(F)F)C(F)(F)C(F)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H5F14NO3/c1-27-9(22,23)8(20,21)24(5(13,14)2(10)11)7(18,19)4(12,3(25)26)6(15,16)17/h2H,1H3,(H,25,26) |
| InChIKey | OYFVCKBZNOBCJY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|