About 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane
3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane (PubChem CID 89342878) has the molecular formula C18H16F2O3S
and a molecular weight of 350.39 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane |
| PubChem CID | 89342878 |
| Molecular Formula | C18H16F2O3S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane |
| SMILES | C=C1CC(c2ccc(F)c(F)c2)C(c2ccc(S(C)(=O)=O)cc2)O1 |
| InChI | InChI=1S/C18H16F2O3S/c1-11-9-15(13-5-8-16(19)17(20)10-13)18(23-11)12-3-6-14(7-4-12)24(2,21)22/h3-8,10,15,18H,1,9H2,2H3 |
| InChIKey | JVHXVRPXWJARSL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane?
The IUPAC name of 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane (CID 89342878) is 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane.
What is the SMILES notation for 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane?
The canonical SMILES for 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane is C=C1CC(c2ccc(F)c(F)c2)C(c2ccc(S(C)(=O)=O)cc2)O1.
What is the InChIKey of 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane?
The InChIKey is JVHXVRPXWJARSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2O3S/c1-11-9-15(13-5-8-16(19)17(20)10-13)18(23-11)12-3-6-14(7-4-12)24(2,21)22/h3-8,10,15,18H,1,9H2,2H3.
What are the key properties of 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane?
3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane has a molecular weight of 350.39 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenyl)-5-methylidene-2-(4-methylsulfonylphenyl)oxolane is sourced from PubChem (CID 89342878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).