C10H15NO2S — CID 89342954
(2E,4Z)-N-prop-2-enylhepta-2,4,6-triene-3-sulfonamide (PubChem CID 89342954) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is (2E,4Z)-N-prop-2-enylhepta-2,4,6-triene-3-sulfonamide.
| Compound Name | (2E,4Z)-N-prop-2-enylhepta-2,4,6-triene-3-sulfonamide |
|---|---|
| PubChem CID | 89342954 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (2E,4Z)-N-prop-2-enylhepta-2,4,6-triene-3-sulfonamide |
| SMILES | C=C/C=C\C(=C/C)S(=O)(=O)NCC=C |
| InChI | InChI=1S/C10H15NO2S/c1-4-7-8-10(6-3)14(12,13)11-9-5-2/h4-8,11H,1-2,9H2,3H3/b8-7-,10-6+ |
| InChIKey | ZRZXSBOHWQKNPG-SDHBEMGISA-N |
| XLogP | 1.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|