C37H43N3O2S — CID 89342981
(2Z,4Z)-2-ethenyl-N-[4-[4-[2-oxo-1-phenyl-2-(propylamino)ethyl]piperidin-1-yl]phenyl]-3-(phenylsulfanylmethyl)hexa-2,4-dienamide (PubChem CID 89342981) has the molecular formula C37H43N3O2S and a molecular weight of 593.84 g/mol. Its IUPAC name is (2Z,4Z)-2-ethenyl-N-[4-[4-[2-oxo-1-phenyl-2-(propylamino)ethyl]piperidin-1-yl]phenyl]-3-(phenylsulfanylmethyl)hexa-2,4-dienamide.
| Compound Name | (2Z,4Z)-2-ethenyl-N-[4-[4-[2-oxo-1-phenyl-2-(propylamino)ethyl]piperidin-1-yl]phenyl]-3-(phenylsulfanylmethyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 89342981 |
| Molecular Formula | C37H43N3O2S |
| Molecular Weight | 593.84 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | (2Z,4Z)-2-ethenyl-N-[4-[4-[2-oxo-1-phenyl-2-(propylamino)ethyl]piperidin-1-yl]phenyl]-3-(phenylsulfanylmethyl)hexa-2,4-dienamide |
| SMILES | C=C/C(C(=O)Nc1ccc(N2CCC(C(C(=O)NCCC)c3ccccc3)CC2)cc1)=C(\C=C/C)CSc1ccccc1 |
| InChI | InChI=1S/C37H43N3O2S/c1-4-13-30(27-43-33-16-11-8-12-17-33)34(6-3)36(41)39-31-18-20-32(21-19-31)40-25-22-29(23-26-40)35(37(42)38-24-5-2)28-14-9-7-10-15-28/h4,6-21,29,35H,3,5,22-27H2,1-2H3,(H,38,42)(H,39,41)/b13-4-,34-30- |
| InChIKey | ZSYFXCMOPPYJCP-HTPFBBKWSA-N |
| XLogP | 8.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.84 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|