About 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole
1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole (PubChem CID 89343171) has the molecular formula C17H16I2N2O
and a molecular weight of 518.14 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole.
Molecular Properties
| Compound Name | 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole |
| PubChem CID | 89343171 |
| Molecular Formula | C17H16I2N2O |
| Molecular Weight | 518.14 g/mol |
| Exact Mass | 517.94 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole |
| SMILES | CCOc1ccc(-n2c(CI)nc3ccc(CI)cc32)cc1 |
| InChI | InChI=1S/C17H16I2N2O/c1-2-22-14-6-4-13(5-7-14)21-16-9-12(10-18)3-8-15(16)20-17(21)11-19/h3-9H,2,10-11H2,1H3 |
| InChIKey | SUSAXDLSUBWJTD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.14 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole?
The IUPAC name of 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole (CID 89343171) is 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole.
What is the SMILES notation for 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole?
The canonical SMILES for 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole is CCOc1ccc(-n2c(CI)nc3ccc(CI)cc32)cc1.
What is the InChIKey of 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole?
The InChIKey is SUSAXDLSUBWJTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16I2N2O/c1-2-22-14-6-4-13(5-7-14)21-16-9-12(10-18)3-8-15(16)20-17(21)11-19/h3-9H,2,10-11H2,1H3.
What are the key properties of 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole?
1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole has a molecular weight of 518.14 g/mol, XLogP of 5.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethoxyphenyl)-2,6-bis(iodomethyl)benzimidazole is sourced from PubChem (CID 89343171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).