About [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone
[4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 8934323) has the molecular formula C21H23N5O
and a molecular weight of 361.45 g/mol. Its IUPAC name is [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| PubChem CID | 8934323 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)N3CCN(c4ccccn4)CC3)cc2)n1 |
| InChI | InChI=1S/C21H23N5O/c1-16-15-17(2)26(23-16)19-8-6-18(7-9-19)21(27)25-13-11-24(12-14-25)20-5-3-4-10-22-20/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | KXNYKSJHNTUBAO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The IUPAC name of [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (CID 8934323) is [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
What is the SMILES notation for [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The canonical SMILES for [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone is Cc1cc(C)n(-c2ccc(C(=O)N3CCN(c4ccccn4)CC3)cc2)n1.
What is the InChIKey of [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The InChIKey is KXNYKSJHNTUBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5O/c1-16-15-17(2)26(23-16)19-8-6-18(7-9-19)21(27)25-13-11-24(12-14-25)20-5-3-4-10-22-20/h3-10,15H,11-14H2,1-2H3.
What are the key properties of [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone?
[4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone has a molecular weight of 361.45 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-dimethylpyrazol-1-yl)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 8934323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).