C21H18N2O5S — CID 8934335
(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate (PubChem CID 8934335) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate.
| Compound Name | (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate |
|---|---|
| PubChem CID | 8934335 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl (3S)-1-oxo-3,4-dihydroisochromene-3-carboxylate |
| SMILES | O=C1O[C@H](C(=O)OCc2cc(=O)n3c4c(sc3n2)CCCC4)Cc2ccccc21 |
| InChI | InChI=1S/C21H18N2O5S/c24-18-10-13(22-21-23(18)15-7-3-4-8-17(15)29-21)11-27-20(26)16-9-12-5-1-2-6-14(12)19(25)28-16/h1-2,5-6,10,16H,3-4,7-9,11H2/t16-/m0/s1 |
| InChIKey | PEZTZLBZUWPXDV-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |