About 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal
2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal (PubChem CID 89343663) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal.
Molecular Properties
| Compound Name | 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal |
| PubChem CID | 89343663 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal |
| SMILES | C/N=C(\C)C(C=O)=C(C)C |
| InChI | InChI=1S/C8H13NO/c1-6(2)8(5-10)7(3)9-4/h5H,1-4H3/b9-7+ |
| InChIKey | APPRSBNQSWQVDD-VQHVLOKHSA-N |
| XLogP | 1.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal?
The IUPAC name of 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal (CID 89343663) is 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal.
What is the SMILES notation for 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal?
The canonical SMILES for 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal is C/N=C(\C)C(C=O)=C(C)C.
What is the InChIKey of 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal?
The InChIKey is APPRSBNQSWQVDD-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H13NO/c1-6(2)8(5-10)7(3)9-4/h5H,1-4H3/b9-7+.
What are the key properties of 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal?
2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal has a molecular weight of 139.20 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enal is sourced from PubChem (CID 89343663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).