C17H27F3O2 — CID 89343824
5-(4-methylcyclohexyl)-2-[(3S)-3,4,5-trifluorocyclohexyl]-1,3-dioxane (PubChem CID 89343824) has the molecular formula C17H27F3O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-(4-methylcyclohexyl)-2-[(3S)-3,4,5-trifluorocyclohexyl]-1,3-dioxane.
| Compound Name | 5-(4-methylcyclohexyl)-2-[(3S)-3,4,5-trifluorocyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 89343824 |
| Molecular Formula | C17H27F3O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 5-(4-methylcyclohexyl)-2-[(3S)-3,4,5-trifluorocyclohexyl]-1,3-dioxane |
| SMILES | CC1CCC(C2COC(C3CC(F)C(F)[C@@H](F)C3)OC2)CC1 |
| InChI | InChI=1S/C17H27F3O2/c1-10-2-4-11(5-3-10)13-8-21-17(22-9-13)12-6-14(18)16(20)15(19)7-12/h10-17H,2-9H2,1H3/t10?,11?,12?,13?,14-,15?,16?,17?/m0/s1 |
| InChIKey | QLPCCXSBXBYIJB-TWIUWELCSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |