About 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene
2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene (PubChem CID 89343835) has the molecular formula C7H5Cl2N
and a molecular weight of 174.03 g/mol. Its IUPAC name is 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene.
Analyze 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene?
The IUPAC name of 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene (CID 89343835) is 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene.
What is the SMILES notation for 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene?
The canonical SMILES for 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene is CC1=C=CN=C(Cl)C=C1Cl.
What is the InChIKey of 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene?
The InChIKey is MUKWBYLMJWTBHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2N/c1-5-2-3-10-7(9)4-6(5)8/h3-4H,1H3.
What are the key properties of 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene?
2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene has a molecular weight of 174.03 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-methyl-1-azacyclohepta-1,3,5,6-tetraene is sourced from PubChem (CID 89343835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).