About (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol
(5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol (PubChem CID 89344035) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol.
Molecular Properties
| Compound Name | (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol |
| PubChem CID | 89344035 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol |
| SMILES | CC12CC3C(O[C@H](O)C3C1)C2O |
| InChI | InChI=1S/C9H14O3/c1-9-2-4-5(3-9)8(11)12-6(4)7(9)10/h4-8,10-11H,2-3H2,1H3/t4?,5?,6?,7?,8-,9?/m0/s1 |
| InChIKey | KRPUZRVHQANOHE-HOBVRZSMSA-N |
| XLogP | 0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol?
The IUPAC name of (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol (CID 89344035) is (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol.
What is the SMILES notation for (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol?
The canonical SMILES for (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol is CC12CC3C(O[C@H](O)C3C1)C2O.
What is the InChIKey of (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol?
The InChIKey is KRPUZRVHQANOHE-HOBVRZSMSA-N. The full InChI is InChI=1S/C9H14O3/c1-9-2-4-5(3-9)8(11)12-6(4)7(9)10/h4-8,10-11H,2-3H2,1H3/t4?,5?,6?,7?,8-,9?/m0/s1.
What are the key properties of (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol?
(5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol has a molecular weight of 170.21 g/mol, XLogP of 0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-methyl-4-oxatricyclo[4.2.1.03,7]nonane-2,5-diol is sourced from PubChem (CID 89344035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).