C17H16N4O3S — CID 89344164
(5S)-5-[(5-methoxy-3-methylidene-1H-isoindol-2-yl)methyl]-5-(1,3-thiazol-2-yl)imidazolidine-2,4-dione (PubChem CID 89344164) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is (5S)-5-[(5-methoxy-3-methylidene-1H-isoindol-2-yl)methyl]-5-(1,3-thiazol-2-yl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(5-methoxy-3-methylidene-1H-isoindol-2-yl)methyl]-5-(1,3-thiazol-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89344164 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (5S)-5-[(5-methoxy-3-methylidene-1H-isoindol-2-yl)methyl]-5-(1,3-thiazol-2-yl)imidazolidine-2,4-dione |
| SMILES | C=C1c2cc(OC)ccc2CN1C[C@]1(c2nccs2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H16N4O3S/c1-10-13-7-12(24-2)4-3-11(13)8-21(10)9-17(15-18-5-6-25-15)14(22)19-16(23)20-17/h3-7H,1,8-9H2,2H3,(H2,19,20,22,23)/t17-/m0/s1 |
| InChIKey | SKDIIAOINLMZHG-KRWDZBQOSA-N |
| XLogP | 1.67 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|